Share to: share facebook share twitter share wa share telegram print page

Ciladopa

Ciladopa
(IUPAC) ime
24-[(2S)-2-(3,4-dimetoksifenil)-2-hidroksietil]piperazin-1-il
Klinički podaci
Identifikatori
ATC kod ?
Hemijski podaci
Formula ?
Farmakoinformacioni podaci
Trudnoća ?
Pravni status

ciklohepta-2,4,6-trien-1-on

| image = Ciladopa Structure.svg | width = | image2 = | width2 =

| tradename = | pregnancy_category = | legal_status = nije kontrolisana supstanca | routes_of_administration = Oralno

| bioavailability = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  DaY | CAS_number = 80109-27-9 | ATC_prefix = none | ATC_suffix = | PubChem = 133371 | IUPHAR_ligand = | ChEMBL_Ref = | ChEMBL = | DrugBank_Ref = | DrugBank = | ChemSpiderID = 117659 | UNII_Ref =  DaY | UNII = D09L486R3J

| C=21 | H=26 | N=2 | O=4 | molecular_weight = 370,44 g/mol | smiles = O=C3/C=C\C=C/C=C3/N2CCN(C[C@@H](O)c1ccc(OC)c(OC)c1)CC2 | InChI = | InChIKey = | StdInChI_Ref =  DaY | StdInChI = 1S/C21H26N2O4/c1-26-20-9-8-16(14-21(20)27-2)19(25)15-22-10-12-23(13-11-22)17-6-4-3-5-7-18(17)24/h3-9,14,19,25H,10-13,15H2,1-2H3/t19-/m1/s1 | StdInChIKey_Ref =  DaY | StdInChIKey = SGEKLKJQLHJVDK-LJQANCHMSA-N }}

Ciladopa (AY-27,110) je dopaminski agonist sa sličnom hemijskom strukturom sa dopaminom.[1] On je bio ispitivan kao mogući antiparkinsonski agens, ali su dalja ispitivanja prekinuta zbog moguće tumorogeneze.[2][3][4][5]

Reference

  1. Voith K (1985). „The comparative long-term effects of ciladopa (AY-27,110), a chemically novel dopaminergic agonist, in 6-OHDA-lesioned and intact rats”. Psychopharmacology 85 (4): 405–9. DOI:10.1007/BF00429654. PMID 3927334. 
  2. Koller WC, Fields JZ, Gordon JH, Perlow MJ (September 1986). „Evaluation of ciladopa hydrochloride as a potential anti-Parkinson drug”. Neuropharmacology 25 (9): 973–9. DOI:10.1016/0028-3908(86)90190-5. PMID 3774130. 
  3. Weiner WJ, Factor SA, Sanchez-Ramos J, Berger J (1987). „A double-blind evaluation of ciladopa in Parkinson's disease”. Movement Disorders : Official Journal of the Movement Disorder Society 2 (3): 211–7. DOI:10.1002/mds.870020308. PMID 3332914. 
  4. Lieberman A, Gopinathan G, Neophytides A, Pasternack P, Goldstein M (May 1987). „Advanced Parkinson's disease: use of partial dopamine agonist, ciladopa”. Neurology 37 (5): 863–5. PMID 3574692. 
  5. Lang AE (August 1987). „Update on dopamine agonists in Parkinson's disease: "beyond bromocriptine"”. The Canadian Journal of Neurological Sciences. Le Journal Canadien Des Sciences Neurologiques 14 (3 Suppl): 474–82. PMID 3315148. 

Vanjske veze

Prefix: a b c d e f g h i j k l m n o p q r s t u v w x y z 0 1 2 3 4 5 6 7 8 9

Portal di Ensiklopedia Dunia

Kembali kehalaman sebelumnya